CAS 1217702-57-2 appears in our catalog under these names: (S)-tert-Butyl 3-(aminomethyl)piperidine-1-carboxylate hydrochloride, 95%, (S)–tert–Butyl 3–(aminomethyl)piperidine–1–carboxylate hydrochloride. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl (3S)-3-(aminomethyl)piperidine-1-carboxylate;hydrochloride (CAS 1217702-57-2) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl (3S)-3-(aminomethyl)piperidine-1-carboxylate;hydrochloride. InChIKey: BHNNXYMAMJEVAA-FVGYRXGTSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl (3S)-3-(aminomethyl)piperidine-1-carboxylate;hydrochloride |
| InChIKey | BHNNXYMAMJEVAA-FVGYRXGTSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)CN.Cl |
Computed by PubChem (NCBI)