CAS 1217776-07-2 appears in our catalog under these names: (R)-2-(Boc-amino)-4-methyl-4-pentenoic acid, 95%, 95%, (R)-2-(Boc-amino)-4-methyl-4-pentenoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (CAS 1217776-07-2) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid. InChIKey: YHWOMLAFEJVSSA-MRVPVSSYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| InChIKey | YHWOMLAFEJVSSA-MRVPVSSYSA-N |
| SMILES | CC(=C)C[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)