CAS 156047-41-5 appears in our catalog under these names: 2-([(tert-Butoxy)carbonyl]amino)-4-methylpent-4-enoic acid, 95%, 2–((tert–Butoxycarbonyl)amino)–4–methylpent–4–enoic acid, boc-2-methallyl-glycine, boc-2-methallyl-glycine 95%, 2-([(tert-Butoxy)carbonyl]amino)-4-methylpent-4-enoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 0,5g.
4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (CAS 156047-41-5) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid. InChIKey: YHWOMLAFEJVSSA-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| InChIKey | YHWOMLAFEJVSSA-UHFFFAOYSA-N |
| SMILES | CC(=C)CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)