CAS 1217820-69-3 appears in our catalog under these names: Emtricitabine-13C,15N2, 95%, Emtricitabine-13C,15N2. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 0,5mg, 5mg, 500 μg.
4-amino-5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl](213C,1,3-15N2)pyrimidin-2-one (CAS 1217820-69-3) is a chemical compound with the molecular formula C8H10FN3O3S and a molecular weight of 250.23 g/mol. IUPAC name: 4-amino-5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl](213C,1,3-15N2)pyrimidin-2-one. InChIKey: XQSPYNMVSIKCOC-SJLFXUEQSA-N.
| Molecular formula | C8H10FN3O3S |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 4-amino-5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl](213C,1,3-15N2)pyrimidin-2-one |
| InChIKey | XQSPYNMVSIKCOC-SJLFXUEQSA-N |
| SMILES | C1[C@H](O[C@H](S1)CO)[15N]2C=C(C(=[15N][13C]2=O)N)F |
Computed by PubChem (NCBI)