CAS 145986-26-1 appears in our catalog under these names: 4-Amino-5-fluoro-1-((2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl)pyrimidin-2(1H)-one, 98%, (2R,5R)-Emtricitabine, Emtricitabine Impurity 20, 5-epi Emtricitabine, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
4-amino-5-fluoro-1-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (CAS 145986-26-1) is a chemical compound with the molecular formula C8H10FN3O3S and a molecular weight of 247.25 g/mol. IUPAC name: 4-amino-5-fluoro-1-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one. InChIKey: XQSPYNMVSIKCOC-PHDIDXHHSA-N.
| Molecular formula | C8H10FN3O3S |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 4-amino-5-fluoro-1-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChIKey | XQSPYNMVSIKCOC-PHDIDXHHSA-N |
| SMILES | C1[C@@H](O[C@H](S1)CO)N2C=C(C(=NC2=O)N)F |
Computed by PubChem (NCBI)