CAS 1251417-93-2 appears in our catalog under these names: 2-(4-Fluorobenzenesulfonamido)-N'-hydroxyethanimidamide, 2-(4-Fluorobenzenesulfonamido)-N'-hydroxyethanimidamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-[(4-fluorophenyl)sulfonylamino]-N'-hydroxyethanimidamide (CAS 1251417-93-2) is a chemical compound with the molecular formula C8H10FN3O3S and a molecular weight of 247.25 g/mol. IUPAC name: 2-[(4-fluorophenyl)sulfonylamino]-N'-hydroxyethanimidamide. InChIKey: VJPBRXUCSHGMLN-UHFFFAOYSA-N.
| Molecular formula | C8H10FN3O3S |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 2-[(4-fluorophenyl)sulfonylamino]-N'-hydroxyethanimidamide |
| InChIKey | VJPBRXUCSHGMLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)NC/C(=N/O)/N |
Computed by PubChem (NCBI)