CAS 137530-41-7 appears in our catalog under these names: Ent-emtricitabine, 95%, (2S,5R)-Emtricitabine, Emtricitabine Enantiomer, ent-Emtricitabine, 4-Amino-5-fluoro-1-((2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl)pyrimidin-2(1H)-one, 95+%. Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, on request, 10mg, 1mg, 0,5mg, 2mg.
4-amino-5-fluoro-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (CAS 137530-41-7) is a chemical compound with the molecular formula C8H10FN3O3S and a molecular weight of 247.25 g/mol. IUPAC name: 4-amino-5-fluoro-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one. InChIKey: XQSPYNMVSIKCOC-RITPCOANSA-N.
| Molecular formula | C8H10FN3O3S |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 4-amino-5-fluoro-1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChIKey | XQSPYNMVSIKCOC-RITPCOANSA-N |
| SMILES | C1[C@@H](O[C@@H](S1)CO)N2C=C(C(=NC2=O)N)F |
Computed by PubChem (NCBI)