Products 145416-34-8
CAS 145416-34-8 appears in our catalog under these names: (2S,5S)-Emtricitabine, 2-epi-Emtricitabine, Emtricitabine Impurity 19, 2-epi-Emtricitabine, >95% (HPLC), 2-epi-(-)-emtricitabine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
4-amino-5-fluoro-1-[(2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (CAS 145416-34-8) is a chemical compound with the molecular formula C8H10FN3O3S and a molecular weight of 247.25 g/mol. IUPAC name: 4-amino-5-fluoro-1-[(2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one. InChIKey: XQSPYNMVSIKCOC-WDSKDSINSA-N.
| Molecular formula | C8H10FN3O3S |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 4-amino-5-fluoro-1-[(2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChIKey | XQSPYNMVSIKCOC-WDSKDSINSA-N |
| SMILES | C1[C@H](O[C@@H](S1)CO)N2C=C(C(=NC2=O)N)F |
Computed by PubChem (NCBI)