CAS 157966-14-8 is the registry number for 5-((3AR,4S,6aS)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid (CAS 157966-14-8) is a chemical compound with the molecular formula C10H16N2O3S and a molecular weight of 244.31 g/mol. IUPAC name: 5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid. InChIKey: YBJHBAHKTGYVGT-BKPPORCPSA-N.
| Molecular formula | C10H16N2O3S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 5-[(3aR,4S,6aS)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
| InChIKey | YBJHBAHKTGYVGT-BKPPORCPSA-N |
| SMILES | C1[C@@H]2[C@H]([C@@H](S1)CCCCC(=O)O)NC(=O)N2 |
Computed by PubChem (NCBI)