CAS 1217858-50-8 appears in our catalog under these names: Phenylephrine-d3 HCl (Methyl-d3), (R)-Phenylephrine-d3 Hydrochloride, >95% (HPLC), Phenylephrine–d3 hydrochloride, (R)-Phenylephrine-(methyl-d3) hydrochloride, Phenylephrine-d3 (hydrochloride). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 25mg, 5mg, 2mg, 10 mg, 25 mg.
3-[(1R)-1-hydroxy-2-(trideuteriomethylamino)ethyl]phenol;hydrochloride (CAS 1217858-50-8) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 206.68 g/mol. IUPAC name: 3-[(1R)-1-hydroxy-2-(trideuteriomethylamino)ethyl]phenol;hydrochloride. InChIKey: OCYSGIYOVXAGKQ-SSUNAKLMSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 206.68 g/mol |
| IUPAC name | 3-[(1R)-1-hydroxy-2-(trideuteriomethylamino)ethyl]phenol;hydrochloride |
| InChIKey | OCYSGIYOVXAGKQ-SSUNAKLMSA-N |
| SMILES | [2H]C([2H])([2H])NC[C@@H](C1=CC(=CC=C1)O)O.Cl |
Computed by PubChem (NCBI)