Products 1276197-50-2
CAS 1276197-50-2 appears in our catalog under these names: Phenylephrine-d3 HCl, Phenylephrine Impurity 47（(R)-Phenylephrine-d3 HCl）, (R)-(-)-Phenylephrine-2,4,6-d3 HCl, 97 atom % D, min 98% Chemical Purity, Phenylephrine–2,4,6–d3 hydrochloride, Phenylephrine-2,4,6-d3 (hydrochloride), 99.90%. Offered by: Chemat Brand, Hubei YoungXin, CDN, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,05g, 0,01g.
2,4,6-trideuterio-3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 1276197-50-2) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 206.68 g/mol. IUPAC name: 2,4,6-trideuterio-3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: OCYSGIYOVXAGKQ-TVZTYWMASA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 206.68 g/mol |
| IUPAC name | 2,4,6-trideuterio-3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| InChIKey | OCYSGIYOVXAGKQ-TVZTYWMASA-N |
| SMILES | [2H]C1=CC(=C(C(=C1[C@H](CNC)O)[2H])O)[2H].Cl |
Computed by PubChem (NCBI)