CAS 939-38-8 appears in our catalog under these names: (S)-Phenylephrine HCl, Phenylephrine Impurity 9, (S)-Phenylephrine Hydrochloride, >95% (HPLC), (S)-Phenylephrine hydrochloride, (S)-Phenylephrine Hydrochloride, ≥98%, ≥98%. Offered by: Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: on request, 100mg, 10mg, 250mg, 25mg, 50mg, 5mg.
3-[(1S)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride (CAS 939-38-8) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: 3-[(1S)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride. InChIKey: OCYSGIYOVXAGKQ-SBSPUUFOSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | 3-[(1S)-1-hydroxy-2-(methylamino)ethyl]phenol;hydrochloride |
| InChIKey | OCYSGIYOVXAGKQ-SBSPUUFOSA-N |
| SMILES | CNC[C@H](C1=CC(=CC=C1)O)O.Cl |
Computed by PubChem (NCBI)