Products 2714485-34-2
CAS 2714485-34-2 appears in our catalog under these names: rac Phenylephrine-d3 Hydrochloride, >95% (HPLC), DL-Phenylephrine-d3 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
3-[1-hydroxy-2-(trideuteriomethylamino)ethyl]phenol;hydrochloride (CAS 2714485-34-2) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 206.68 g/mol. IUPAC name: 3-[1-hydroxy-2-(trideuteriomethylamino)ethyl]phenol;hydrochloride. InChIKey: OCYSGIYOVXAGKQ-NIIDSAIPSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 206.68 g/mol |
| IUPAC name | 3-[1-hydroxy-2-(trideuteriomethylamino)ethyl]phenol;hydrochloride |
| InChIKey | OCYSGIYOVXAGKQ-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCC(C1=CC(=CC=C1)O)O.Cl |
Computed by PubChem (NCBI)