Products 1218557-77-7
CAS 1218557-77-7 is the registry number for 1-((2-Phenyl-1,3-oxazol-4-yl)methyl)piperidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidine-2-carboxylic acid (CAS 1218557-77-7) is a chemical compound with the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. IUPAC name: 1-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidine-2-carboxylic acid. InChIKey: LPVNHKUYOVVRPJ-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O3 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | 1-[(2-phenyl-1,3-oxazol-4-yl)methyl]piperidine-2-carboxylic acid |
| InChIKey | LPVNHKUYOVVRPJ-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)CC2=COC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)