Products 1219020-69-5
CAS 1219020-69-5 appears in our catalog under these names: 2,4-Difluoro-3-(1-methylethoxy)benzoic acid, 95%, 2,4-Difluoro-3-isopropoxybenzoic acid, 95+%, 2,4-Difluoro-3-(1-methylethoxy)benzoic acid, ≥95%, 2,4-Difluoro-3-isopropoxybenzoic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2,4-difluoro-3-propan-2-yloxybenzoic acid (CAS 1219020-69-5) is a chemical compound with the molecular formula C10H10F2O3 and a molecular weight of 216.18 g/mol. IUPAC name: 2,4-difluoro-3-propan-2-yloxybenzoic acid. InChIKey: NHOAPOQTLPZFMW-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O3 |
|---|---|
| Molecular weight | 216.18 g/mol |
| IUPAC name | 2,4-difluoro-3-propan-2-yloxybenzoic acid |
| InChIKey | NHOAPOQTLPZFMW-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1F)C(=O)O)F |
Computed by PubChem (NCBI)