Products 1219038-32-0
CAS 1219038-32-0 appears in our catalog under these names: Arachidonic Acid Alkyne, Arachidonic Acid Alkyne, ARACHIDONIC ACID-ALKYNE, Arachidonic acid-alkyne, 99.9%. Offered by: TRC, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 25mg, 1mg, 100μg, 500μg, 500 μg, 1 mg, 10 mg, 25 mg.
(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraen-19-ynoic acid (CAS 1219038-32-0) is a chemical compound with the molecular formula C20H28O2 and a molecular weight of 300.4 g/mol. IUPAC name: (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraen-19-ynoic acid. InChIKey: DTSYXKMUESYRSH-DOFZRALJSA-N.
| Molecular formula | C20H28O2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraen-19-ynoic acid |
| InChIKey | DTSYXKMUESYRSH-DOFZRALJSA-N |
| SMILES | C#CCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
Computed by PubChem (NCBI)