Products 1219531-58-4
CAS 1219531-58-4 is the registry number for Anagrelide-13C3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg, 5 mg.
6,7-dichloro-3,5-dihydro-1H-(2,4,5-13C3)imidazolo[2,1-b]quinazolin-2-one (CAS 1219531-58-4) is a chemical compound with the molecular formula C10H7Cl2N3O and a molecular weight of 259.06 g/mol. IUPAC name: 6,7-dichloro-3,5-dihydro-1H-(2,4,5-13C3)imidazolo[2,1-b]quinazolin-2-one. InChIKey: OTBXOEAOVRKTNQ-PTCNTQLJSA-N.
| Molecular formula | C10H7Cl2N3O |
|---|---|
| Molecular weight | 259.06 g/mol |
| IUPAC name | 6,7-dichloro-3,5-dihydro-1H-(2,4,5-13C3)imidazolo[2,1-b]quinazolin-2-one |
| InChIKey | OTBXOEAOVRKTNQ-PTCNTQLJSA-N |
| SMILES | C1C2=C(C=CC(=C2Cl)Cl)N=[13C]3N1[13CH2][13C](=O)N3 |
Computed by PubChem (NCBI)