CAS 199983-19-2 is the registry number for N-(5,7-Dichloro-1,8-naphthyridin-2-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5,7-dichloro-1,8-naphthyridin-2-yl)acetamide (CAS 199983-19-2) is a chemical compound with the molecular formula C10H7Cl2N3O and a molecular weight of 256.08 g/mol. IUPAC name: N-(5,7-dichloro-1,8-naphthyridin-2-yl)acetamide. InChIKey: JARDFHBWMMNMHU-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | N-(5,7-dichloro-1,8-naphthyridin-2-yl)acetamide |
| InChIKey | JARDFHBWMMNMHU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC2=C(C=C1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)