CAS 58905-16-1 appears in our catalog under these names: 1-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethan-1-one, 96%, 1-(2,4-Dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone, 1–(2,4–DICHLOROLPHENYL)–2–(1H–1,2,4–TRIAZOLE–1–YL)–ETHANONE, 1-(2,4-dichlorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanone, 96%, 96%, Terconazole Impurity 5. Offered by: Fluorochem, TRC, Dr. Ehrenstorfer, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg, 25mg, 5g, on request.
1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone (CAS 58905-16-1) is a chemical compound with the molecular formula C10H7Cl2N3O and a molecular weight of 256.08 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone. InChIKey: XOHMICFWUQPTNP-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| InChIKey | XOHMICFWUQPTNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)CN2C=NC=N2 |
Computed by PubChem (NCBI)