CAS 90723-86-7 appears in our catalog under these names: 2,4-Dichloro-6-(4-methoxyphenyl)-1,3,5-triazine, 95%, 2,4–Dichloro–6–(4–methoxyphenyl)–1,3,5–triazine, 2,4-Dichloro-6-(4-methoxyphenyl)-1,3,5-triazine 95%, 2,4-Dichloro-6-(4-Methoxyphenyl)-1,3,5-Triazine, 95%+, 95%+, 2,4-DICHLORO-6-(4-METHOXYPHENYL)-1,3,5-TRIAZINE, 95%+(GC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 500g, 100g, 25g, 10g, 50g.
2,4-dichloro-6-(4-methoxyphenyl)-1,3,5-triazine (CAS 90723-86-7) is a chemical compound with the molecular formula C10H7Cl2N3O and a molecular weight of 256.08 g/mol. IUPAC name: 2,4-dichloro-6-(4-methoxyphenyl)-1,3,5-triazine. InChIKey: JOYIXJKYQUJKQO-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 2,4-dichloro-6-(4-methoxyphenyl)-1,3,5-triazine |
| InChIKey | JOYIXJKYQUJKQO-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)