CAS 132653-23-7 is the registry number for 1-(2,4-Dichlorophenyl)-2-(4H-1,2,4-triazol-4-yl)ethanone. Offered by: TRC. Available pack sizes: 250mg, 50mg.
1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-4-yl)ethanone (CAS 132653-23-7) is a chemical compound with the molecular formula C10H7Cl2N3O and a molecular weight of 256.08 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-4-yl)ethanone. InChIKey: FFWSWNHCDIRKPZ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3O |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-4-yl)ethanone |
| InChIKey | FFWSWNHCDIRKPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)CN2C=NN=C2 |
Computed by PubChem (NCBI)