Products 1219589-06-6
CAS 1219589-06-6 appears in our catalog under these names: 2-Methyl-5-(1h-pyrazol-1-yl)benzenesulfonyl chloride, 95%, 2-Methyl-5-(1H-pyrazol-1-yl)benzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
2-methyl-5-pyrazol-1-ylbenzenesulfonyl chloride (CAS 1219589-06-6) is a chemical compound with the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. IUPAC name: 2-methyl-5-pyrazol-1-ylbenzenesulfonyl chloride. InChIKey: VTDPIPJSPHXLRL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2S |
|---|---|
| Molecular weight | 256.71 g/mol |
| IUPAC name | 2-methyl-5-pyrazol-1-ylbenzenesulfonyl chloride |
| InChIKey | VTDPIPJSPHXLRL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C=CC=N2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)