CAS 912569-59-6 appears in our catalog under these names: 3-(1-Methyl-1h-pyrazol-3-yl)benzenesulfonyl chloride, 95%, 3-(1-Methyl-1H-pyrazol-3-yl)benzenesulfonyl chloride, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg.
3-(1-methylpyrazol-3-yl)benzenesulfonyl chloride (CAS 912569-59-6) is a chemical compound with the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. IUPAC name: 3-(1-methylpyrazol-3-yl)benzenesulfonyl chloride. InChIKey: QGUULJKRHYTFTP-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2S |
|---|---|
| Molecular weight | 256.71 g/mol |
| IUPAC name | 3-(1-methylpyrazol-3-yl)benzenesulfonyl chloride |
| InChIKey | QGUULJKRHYTFTP-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)C2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)