CAS 342405-38-3 appears in our catalog under these names: 5-Methyl-1-phenyl-1H-pyrazole-4-sulfonyl chloride, 97%, 5-Methyl-1-phenyl-1H-pyrazole-4-sulfonyl chloride, 95% , 5-Methyl-1-phenyl-1H-pyrazole-4-sulfonyl chloride 98%, 5-Methyl-1-phenyl-1H-pyrazole-4-sulfonyl chloride, 95%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
5-methyl-1-phenylpyrazole-4-sulfonyl chloride (CAS 342405-38-3) is a chemical compound with the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. IUPAC name: 5-methyl-1-phenylpyrazole-4-sulfonyl chloride. InChIKey: IRJCRNZTDRODFQ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2S |
|---|---|
| Molecular weight | 256.71 g/mol |
| IUPAC name | 5-methyl-1-phenylpyrazole-4-sulfonyl chloride |
| InChIKey | IRJCRNZTDRODFQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)