Products 1955494-62-8
CAS 1955494-62-8 appears in our catalog under these names: 4-methyl-2-(3-nitrophenyl)-1,3-thiazole hydrochloride, 95%, 4-Methyl-2-(3-nitrophenyl)-1,3-thiazole hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-methyl-2-(3-nitrophenyl)-1,3-thiazole;hydrochloride (CAS 1955494-62-8) is a chemical compound with the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. IUPAC name: 4-methyl-2-(3-nitrophenyl)-1,3-thiazole;hydrochloride. InChIKey: CFMROGFZALDJCM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2S |
|---|---|
| Molecular weight | 256.71 g/mol |
| IUPAC name | 4-methyl-2-(3-nitrophenyl)-1,3-thiazole;hydrochloride |
| InChIKey | CFMROGFZALDJCM-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=CC(=CC=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)