Products 186551-65-5

CAS 186551-65-5 is the registry number for 4-(1-Methyl-1H-imidazol-2-yl)benzenesulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(1-methylimidazol-2-yl)benzenesulfonyl chloride (CAS 186551-65-5) is a chemical compound with the molecular formula C10H9ClN2O2S and a molecular weight of 256.71 g/mol. IUPAC name: 4-(1-methylimidazol-2-yl)benzenesulfonyl chloride. InChIKey: XLFSJIGVCSPHDH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClN2O2S
Molecular weight256.71 g/mol
IUPAC name4-(1-methylimidazol-2-yl)benzenesulfonyl chloride
InChIKeyXLFSJIGVCSPHDH-UHFFFAOYSA-N
SMILESCN1C=CN=C1C2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)