CAS 1219795-20-6 appears in our catalog under these names: N,N'-Dibenzylethylene-d4-diamine, 98 atom % D, min 98% Chemical Purity, N,N'-Dibenzylethylenediamine-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
N,N'-dibenzyl-1,1,2,2-tetradeuterioethane-1,2-diamine (CAS 1219795-20-6) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 244.37 g/mol. IUPAC name: N,N'-dibenzyl-1,1,2,2-tetradeuterioethane-1,2-diamine. InChIKey: JUHORIMYRDESRB-AREBVXNXSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 244.37 g/mol |
| IUPAC name | N,N'-dibenzyl-1,1,2,2-tetradeuterioethane-1,2-diamine |
| InChIKey | JUHORIMYRDESRB-AREBVXNXSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])NCC1=CC=CC=C1)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)