CAS 1219799-03-7 appears in our catalog under these names: 2-Methylpropyl-d9-amine HCl, 98 atom % D, min 98% Chemical Purity, 2-Methylpropan-1-amine-d9 (hydrochloride), 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10 mg, 5 mg, 25 mg.
1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1219799-03-7) is a chemical compound with the molecular formula C4H12ClN and a molecular weight of 118.65 g/mol. IUPAC name: 1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: BSMNBEHEFWDHJD-RWWZLFSGSA-N.
| Molecular formula | C4H12ClN |
|---|---|
| Molecular weight | 118.65 g/mol |
| IUPAC name | 1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | BSMNBEHEFWDHJD-RWWZLFSGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)