Products 285132-87-8

CAS 285132-87-8 is the registry number for Diethyl-d10-amine HCl, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.

Structural formula: {0} (CAS {1})

1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine;hydrochloride (CAS 285132-87-8) is a chemical compound with the molecular formula C4H12ClN and a molecular weight of 119.66 g/mol. IUPAC name: 1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine;hydrochloride. InChIKey: HDITUCONWLWUJR-MFMGRUKYSA-N.

Identity
Molecular formulaC4H12ClN
Molecular weight119.66 g/mol
IUPAC name1,1,2,2,2-pentadeuterio-N-(1,1,2,2,2-pentadeuterioethyl)ethanamine;hydrochloride
InChIKeyHDITUCONWLWUJR-MFMGRUKYSA-N
SMILES[2H]C([2H])([2H])C([2H])([2H])NC([2H])([2H])C([2H])([2H])[2H].Cl

Computed by PubChem (NCBI)