Products 1219802-18-2
CAS 1219802-18-2 appears in our catalog under these names: Quinoline-2-carboxylic acid-d6, Quinaldic-d6 Acid, 99 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,05g, 0,01g.
3,4,5,6,7,8-hexadeuterioquinoline-2-carboxylic acid (CAS 1219802-18-2) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 179.20 g/mol. IUPAC name: 3,4,5,6,7,8-hexadeuterioquinoline-2-carboxylic acid. InChIKey: LOAUVZALPPNFOQ-MZWXYZOWSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 179.20 g/mol |
| IUPAC name | 3,4,5,6,7,8-hexadeuterioquinoline-2-carboxylic acid |
| InChIKey | LOAUVZALPPNFOQ-MZWXYZOWSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=N2)C(=O)O)[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)