Products 1219803-34-5
CAS 1219803-34-5 appears in our catalog under these names: 3,4-Dimethoxyphenylacetonitrile-alpha,alpha-d2, 98 atom % D, min 98% Chemical Purity, 3,4-Dimethoxyphenylacetonitrile-α,α-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 5 mg, 100 mg, 25 mg, 50 mg, 10 mg.
2,2-dideuterio-2-(3,4-dimethoxyphenyl)acetonitrile (CAS 1219803-34-5) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 179.21 g/mol. IUPAC name: 2,2-dideuterio-2-(3,4-dimethoxyphenyl)acetonitrile. InChIKey: ASLSUMISAQDOOB-BFWBPSQCSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 179.21 g/mol |
| IUPAC name | 2,2-dideuterio-2-(3,4-dimethoxyphenyl)acetonitrile |
| InChIKey | ASLSUMISAQDOOB-BFWBPSQCSA-N |
| SMILES | [2H]C([2H])(C#N)C1=CC(=C(C=C1)OC)OC |
Computed by PubChem (NCBI)