Products 1219803-66-3

CAS 1219803-66-3 is the registry number for (±)-2-(2,4-Dichlorophenoxy-d3)propionic Acid, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g, 0,01g.

Structural formula: {0} (CAS {1})

2-(2,4-dichloro-3,5,6-trideuteriophenoxy)propanoic acid (CAS 1219803-66-3) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 238.08 g/mol. IUPAC name: 2-(2,4-dichloro-3,5,6-trideuteriophenoxy)propanoic acid. InChIKey: MZHCENGPTKEIGP-NRUYWUNFSA-N.

Identity
Molecular formulaC9H8Cl2O3
Molecular weight238.08 g/mol
IUPAC name2-(2,4-dichloro-3,5,6-trideuteriophenoxy)propanoic acid
InChIKeyMZHCENGPTKEIGP-NRUYWUNFSA-N
SMILES[2H]C1=C(C(=C(C(=C1OC(C)C(=O)O)Cl)[2H])Cl)[2H]

Computed by PubChem (NCBI)