CAS 90348-69-9 appears in our catalog under these names: (3,5-Dichloro-2-methoxyphenyl)acetic acid, 95%, 2–(3,5–Dichloro–2–methoxyphenyl)acetic acid, 2-(3,5-Dichloro-2-methoxyphenyl)acetic acid 95%, (3,5-Dichloro-2-methoxyphenyl)acetic acid, 95%, 95%, (3,5-Dichloro-2-methoxyphenyl)acetic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg, 500mg.
2-(3,5-dichloro-2-methoxyphenyl)acetic acid (CAS 90348-69-9) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 2-(3,5-dichloro-2-methoxyphenyl)acetic acid. InChIKey: SCCIRTQIRBQPBT-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2-(3,5-dichloro-2-methoxyphenyl)acetic acid |
| InChIKey | SCCIRTQIRBQPBT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)