Products 2179038-35-6
CAS 2179038-35-6 appears in our catalog under these names: Methyl 2,3-Dichloro-6-methoxybenzoate, Methyl 2,3-dichloro-6-methoxybenzoate, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
Methyl 2,3-dichloro-6-methoxybenzoate (CAS 2179038-35-6) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: methyl 2,3-dichloro-6-methoxybenzoate. InChIKey: XXQOXAXFFABJDK-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | methyl 2,3-dichloro-6-methoxybenzoate |
| InChIKey | XXQOXAXFFABJDK-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)