Products 1219803-79-8
CAS 1219803-79-8 is the registry number for 3-Chlorotoluene-2,4,6-d3, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
2-chloro-1,3,5-trideuterio-4-methylbenzene (CAS 1219803-79-8) is a chemical compound with the molecular formula C7H7Cl and a molecular weight of 129.60 g/mol. IUPAC name: 2-chloro-1,3,5-trideuterio-4-methylbenzene. InChIKey: OSOUNOBYRMOXQQ-QGZYMEECSA-N.
| Molecular formula | C7H7Cl |
|---|---|
| Molecular weight | 129.60 g/mol |
| IUPAC name | 2-chloro-1,3,5-trideuterio-4-methylbenzene |
| InChIKey | OSOUNOBYRMOXQQ-QGZYMEECSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1C)[2H])Cl)[2H] |
Computed by PubChem (NCBI)