CAS 59502-05-5 appears in our catalog under these names: Benzyl-d7 Chloride, Benzyl-d7 Chloride, 99 atom % D, min 98% Chemical Purity, BENZYL-D7 CHLORIDE, 99+ ATOM % D. Offered by: TRC, CDN, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-[chloro(dideuterio)methyl]-2,3,4,5,6-pentadeuteriobenzene (CAS 59502-05-5) is a chemical compound with the molecular formula C7H7Cl and a molecular weight of 133.62 g/mol. IUPAC name: 1-[chloro(dideuterio)methyl]-2,3,4,5,6-pentadeuteriobenzene. InChIKey: KCXMKQUNVWSEMD-XZJKGWKKSA-N.
| Molecular formula | C7H7Cl |
|---|---|
| Molecular weight | 133.62 g/mol |
| IUPAC name | 1-[chloro(dideuterio)methyl]-2,3,4,5,6-pentadeuteriobenzene |
| InChIKey | KCXMKQUNVWSEMD-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])Cl)[2H])[2H] |
Computed by PubChem (NCBI)