Products 33712-34-4
CAS 33712-34-4 appears in our catalog under these names: Benzyl-alpha-alpha-d2 Chloride, 98 atom % D, min 98% Chemical Purity, Benzyl-α,α-d2 chloride. Offered by: CDN, Biosynth. Available pack sizes: 0,5g, 0,25g, 250mg.
[chloro(dideuterio)methyl]benzene (CAS 33712-34-4) is a chemical compound with the molecular formula C7H7Cl and a molecular weight of 128.59 g/mol. IUPAC name: [chloro(dideuterio)methyl]benzene. InChIKey: KCXMKQUNVWSEMD-NCYHJHSESA-N.
| Molecular formula | C7H7Cl |
|---|---|
| Molecular weight | 128.59 g/mol |
| IUPAC name | [chloro(dideuterio)methyl]benzene |
| InChIKey | KCXMKQUNVWSEMD-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(C1=CC=CC=C1)Cl |
Computed by PubChem (NCBI)