CAS 84344-06-9 is the registry number for 4-Chlorotoluene-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
1-chloro-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene (CAS 84344-06-9) is a chemical compound with the molecular formula C7H7Cl and a molecular weight of 133.62 g/mol. IUPAC name: 1-chloro-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene. InChIKey: NPDACUSDTOMAMK-AAYPNNLASA-N.
| Molecular formula | C7H7Cl |
|---|---|
| Molecular weight | 133.62 g/mol |
| IUPAC name | 1-chloro-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene |
| InChIKey | NPDACUSDTOMAMK-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)