Products 84344-06-9

CAS 84344-06-9 is the registry number for 4-Chlorotoluene-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

1-chloro-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene (CAS 84344-06-9) is a chemical compound with the molecular formula C7H7Cl and a molecular weight of 133.62 g/mol. IUPAC name: 1-chloro-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene. InChIKey: NPDACUSDTOMAMK-AAYPNNLASA-N.

Identity
Molecular formulaC7H7Cl
Molecular weight133.62 g/mol
IUPAC name1-chloro-2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzene
InChIKeyNPDACUSDTOMAMK-AAYPNNLASA-N
SMILES[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])Cl)[2H]

Computed by PubChem (NCBI)