Products 85577-24-8

CAS 85577-24-8 is the registry number for 4-Chlorotoluene-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

1-chloro-2,3,5,6-tetradeuterio-4-methylbenzene (CAS 85577-24-8) is a chemical compound with the molecular formula C7H7Cl and a molecular weight of 130.61 g/mol. IUPAC name: 1-chloro-2,3,5,6-tetradeuterio-4-methylbenzene. InChIKey: NPDACUSDTOMAMK-QFFDRWTDSA-N.

Identity
Molecular formulaC7H7Cl
Molecular weight130.61 g/mol
IUPAC name1-chloro-2,3,5,6-tetradeuterio-4-methylbenzene
InChIKeyNPDACUSDTOMAMK-QFFDRWTDSA-N
SMILES[2H]C1=C(C(=C(C(=C1C)[2H])[2H])Cl)[2H]

Computed by PubChem (NCBI)