Products 1219804-02-0
CAS 1219804-02-0 is the registry number for Methylphenidate-d9 HCl (piperidine-d9), 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g.
Methyl 2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetate;hydrochloride (CAS 1219804-02-0) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 278.82 g/mol. IUPAC name: methyl 2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetate;hydrochloride. InChIKey: JUMYIBMBTDDLNG-YURDIMOXSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 278.82 g/mol |
| IUPAC name | methyl 2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetate;hydrochloride |
| InChIKey | JUMYIBMBTDDLNG-YURDIMOXSA-N |
| SMILES | [2H]C1(C(C(NC(C1([2H])[2H])([2H])C(C2=CC=CC=C2)C(=O)OC)([2H])[2H])([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)