Products 1219805-50-1
CAS 1219805-50-1 appears in our catalog under these names: 2,6-Dichlorobenzoic-d3 Acid, 98 atom % D, min 98% Chemical Purity, 2,6-Dichlorobenzoic acid-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
2,6-dichloro-3,4,5-trideuteriobenzoic acid (CAS 1219805-50-1) is a chemical compound with the molecular formula C7H4Cl2O2 and a molecular weight of 194.03 g/mol. IUPAC name: 2,6-dichloro-3,4,5-trideuteriobenzoic acid. InChIKey: MRUDNSFOFOQZDA-CBYSEHNBSA-N.
| Molecular formula | C7H4Cl2O2 |
|---|---|
| Molecular weight | 194.03 g/mol |
| IUPAC name | 2,6-dichloro-3,4,5-trideuteriobenzoic acid |
| InChIKey | MRUDNSFOFOQZDA-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Cl)C(=O)O)Cl)[2H] |
Computed by PubChem (NCBI)