CAS 1219805-85-2 appears in our catalog under these names: Bis(4-chlorophenyl-2,3,5,6-d4)methyl Alcohol, 98 atom % D, min 98% Chemical Purity, Bis(4-chlorophenyl-2,3,5,6)methyl Alcohol-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
Bis(4-chloro-2,3,5,6-tetradeuteriophenyl)methanol (CAS 1219805-85-2) is a chemical compound with the molecular formula C13H10Cl2O and a molecular weight of 261.17 g/mol. IUPAC name: bis(4-chloro-2,3,5,6-tetradeuteriophenyl)methanol. InChIKey: PHUYGURFBULKPA-PGRXLJNUSA-N.
| Molecular formula | C13H10Cl2O |
|---|---|
| Molecular weight | 261.17 g/mol |
| IUPAC name | bis(4-chloro-2,3,5,6-tetradeuteriophenyl)methanol |
| InChIKey | PHUYGURFBULKPA-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(C2=C(C(=C(C(=C2[2H])[2H])Cl)[2H])[2H])O)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)