CAS 1219832-07-1 is the registry number for 7-tert-Butyl-5-bromo-1h-indole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
5-bromo-7-tert-butyl-1H-indole (CAS 1219832-07-1) is a chemical compound with the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. IUPAC name: 5-bromo-7-tert-butyl-1H-indole. InChIKey: QKIISZAYBIVXOG-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN |
|---|---|
| Molecular weight | 252.15 g/mol |
| IUPAC name | 5-bromo-7-tert-butyl-1H-indole |
| InChIKey | QKIISZAYBIVXOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C2C(=CC(=C1)Br)C=CN2 |
Computed by PubChem (NCBI)