CAS 1478735-16-8 is the registry number for 6'-Bromo-3',4'-dihydro-1'h-spiro[azetidine-2,2'-naphthalene], 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.
7-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-azetidine] (CAS 1478735-16-8) is a chemical compound with the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. IUPAC name: 7-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-azetidine]. InChIKey: GMNLMXHJWDBLEQ-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN |
|---|---|
| Molecular weight | 252.15 g/mol |
| IUPAC name | 7-bromospiro[2,4-dihydro-1H-naphthalene-3,2'-azetidine] |
| InChIKey | GMNLMXHJWDBLEQ-UHFFFAOYSA-N |
| SMILES | C1CC2(CCN2)CC3=C1C=C(C=C3)Br |
Computed by PubChem (NCBI)