Products 180912-08-7
CAS 180912-08-7 is the registry number for 4-(4-Bromophenyl)-1-methyl-3,6-dihydro-2H-pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-(4-bromophenyl)-1-methyl-3,6-dihydro-2H-pyridine (CAS 180912-08-7) is a chemical compound with the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. IUPAC name: 4-(4-bromophenyl)-1-methyl-3,6-dihydro-2H-pyridine. InChIKey: ZLTVWHVXRJSJMU-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN |
|---|---|
| Molecular weight | 252.15 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1-methyl-3,6-dihydro-2H-pyridine |
| InChIKey | ZLTVWHVXRJSJMU-UHFFFAOYSA-N |
| SMILES | CN1CCC(=CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)