CAS 371220-28-9 appears in our catalog under these names: 7-Bromo-1-isopropyl-3,4-dihydroisoquinoline, 95%, 7-Bromo-1-isopropyl-3,4-dihydroisoquinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline (CAS 371220-28-9) is a chemical compound with the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. IUPAC name: 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline. InChIKey: LTMLXRYRVYESQC-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN |
|---|---|
| Molecular weight | 252.15 g/mol |
| IUPAC name | 7-bromo-1-propan-2-yl-3,4-dihydroisoquinoline |
| InChIKey | LTMLXRYRVYESQC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NCCC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)