CAS 2922763-42-4 is the registry number for 7'-Bromo-5'-methyl-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-isoquinoline], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-methylspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopropane] (CAS 2922763-42-4) is a chemical compound with the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. IUPAC name: 7-bromo-5-methylspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopropane]. InChIKey: WZRVOKGUSLLNNI-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN |
|---|---|
| Molecular weight | 252.15 g/mol |
| IUPAC name | 7-bromo-5-methylspiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopropane] |
| InChIKey | WZRVOKGUSLLNNI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C3(CC3)CNC2)Br |
Computed by PubChem (NCBI)