CAS 122-25-8 appears in our catalog under these names: 5,5'–Methylenedisalicylic acid, 5,5'-Methylenedisalicylic acid, 95%, 5,5'-Methylenebis(2-hydroxybenzoic acid). Offered by: GLPBio, Thermo Scientific (Acros), Chemat. Available pack sizes: 1g, 5g, 25g, 100g.
5-[(3-carboxy-4-hydroxyphenyl)methyl]-2-hydroxybenzoic acid (CAS 122-25-8) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: 5-[(3-carboxy-4-hydroxyphenyl)methyl]-2-hydroxybenzoic acid. InChIKey: JWQFKVGACKJIAV-UHFFFAOYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 5-[(3-carboxy-4-hydroxyphenyl)methyl]-2-hydroxybenzoic acid |
| InChIKey | JWQFKVGACKJIAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC2=CC(=C(C=C2)O)C(=O)O)C(=O)O)O |
Computed by PubChem (NCBI)