CAS 65982-77-6 appears in our catalog under these names: Omega-benzoyloxy phloracetophenone, 95%, omega-Benzoyloxy phloracetophenone, ω-Benzoyl oxyphloracetophenone. Offered by: Combi-blocks, Biosynth, MedChemExpress. Available pack sizes: 100mg, 250mg, 0,25g, 0,1g, 0,5g, 1g, Get quote.
[2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl] benzoate (CAS 65982-77-6) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: [2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl] benzoate. InChIKey: RJDUTONJXJJEBT-UHFFFAOYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | [2-oxo-2-(2,4,6-trihydroxyphenyl)ethyl] benzoate |
| InChIKey | RJDUTONJXJJEBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC(=O)C2=C(C=C(C=C2O)O)O |
Computed by PubChem (NCBI)