CAS 31477-95-9 is the registry number for Dihydrodatiscetin. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(2R,3R)-3,5,7-trihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one (CAS 31477-95-9) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: (2R,3R)-3,5,7-trihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one. InChIKey: BJNCWLSOQIVKIX-LSDHHAIUSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | (2R,3R)-3,5,7-trihydroxy-2-(2-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| InChIKey | BJNCWLSOQIVKIX-LSDHHAIUSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H]2[C@H](C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
Computed by PubChem (NCBI)